CAS 1185303-69-8
:1-Piperazinepropanoic acid, 4-ethyl-, hydrochloride (1:2)
Description:
1-Piperazinepropanoic acid, 4-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and propanoic acid moieties, which contribute to its biological activity and potential pharmaceutical applications. The presence of the ethyl group at the 4-position of the piperazine ring enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in various formulations. This compound may exhibit properties such as being a zwitterion, which can affect its pharmacokinetics and bioavailability. Its structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas. However, specific biological activities, toxicity, and detailed physicochemical properties would require further investigation through experimental studies and literature review.
Formula:C9H18N2O2·2ClH
InChI:InChI=1S/C9H18N2O2.2ClH/c1-2-10-5-7-11(8-6-10)4-3-9(12)13;;/h2-8H2,1H3,(H,12,13);2*1H
InChI key:InChIKey=AGPZIQZBOIOKFE-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1CCN(CC)CC1.Cl
Synonyms:- 1-Piperazinepropanoic acid, 4-ethyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
