CAS 1185303-83-6

Piperidine, 3-[[(2-methylphenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[(2-methylphenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a methoxy group attached to a 2-methylphenyl moiety, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the methoxy and phenyl groups may influence its lipophilicity and interaction with biological targets. Piperidine derivatives are often studied for their pharmacological properties, including analgesic and psychoactive effects. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature sources. Overall, this compound exemplifies the diverse chemistry of piperidine derivatives and their potential relevance in medicinal chemistry.

Formula: C₁₄H₂₁NO·ClH

InChI: InChI=1S/C14H21NO.ClH/c1-12-5-2-3-7-14(12)11-16-10-13-6-4-8-15-9-13;/h2-3,5,7,13,15H,4,6,8-11H2,1H3;1H

InChI key: InChIKey=WAUGTOPIEONWPT-UHFFFAOYSA-N

SMILES: C(OCC1CCCNC1)C2=C(C)C=CC=C2.Cl

Synonyms:

• Piperidine, 3-[[(2-methylphenyl)methoxy]methyl]-, hydrochloride (1:1)

3-(((2-Methylbenzyl)oxy)methyl)piperidine hydrochloride

CAS: 1185303-83-6

Formula: C₁₄H₂₂ClNO

Molecular weight: 255.7836

Ref: IN-DA008ZJN