CAS 1185303-84-7

1H-Pyrrolo[2,3-b]pyridine, 2-(3-piperidinyl)-, hydrochloride (1:2)

Description:

1H-Pyrrolo[2,3-b]pyridine, 2-(3-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. This compound features a piperidine substituent at the 2-position of the pyrrolo ring, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery processes. Safety and handling precautions should be observed, as with all chemical substances, and its stability, reactivity, and specific applications would depend on further empirical studies. Overall, this compound represents a fascinating area of research within the field of organic and medicinal chemistry.

Formula: C₁₂H₁₅N₃·2ClH

InChI: InChI=1S/C12H15N3.2ClH/c1-4-10(8-13-5-1)11-7-9-3-2-6-14-12(9)15-11;;/h2-3,6-7,10,13H,1,4-5,8H2,(H,14,15);2*1H

InChI key: InChIKey=QUMFUHSMDXBITD-UHFFFAOYSA-N

SMILES: C1(=CC=2C(N1)=NC=CC2)C3CCCNC3.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 2-(3-piperidinyl)-, hydrochloride (1:2)