CAS 1185303-89-2

Piperidine, 3-[(2-bromo-4-methylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(2-bromo-4-methylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a side chain that includes a 2-bromo-4-methylphenoxy group, indicating the presence of a bromine atom and a methyl group on the aromatic ring. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the bromine atom may impart specific reactivity or biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the hydrochloride form often improves stability and handling characteristics, making it suitable for laboratory and industrial use. Safety data should be consulted to understand its toxicity and handling precautions, as with any chemical substance.

Formula: C₁₃H₁₈BrNO·ClH

InChI: InChI=1S/C13H18BrNO.ClH/c1-10-4-5-13(12(14)7-10)16-9-11-3-2-6-15-8-11;/h4-5,7,11,15H,2-3,6,8-9H2,1H3;1H

InChI key: InChIKey=HLNJZTCTQJNNAP-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=C(Br)C=C(C)C=C2.Cl

Synonyms:

• Piperidine, 3-[(2-bromo-4-methylphenoxy)methyl]-, hydrochloride (1:1)