
CAS 1185303-91-6
:1-Naphthalenemethanamine, N-(2-methoxy-1-methylethyl)-, ethanedioate (1:1)
Description:
1-Naphthalenemethanamine, N-(2-methoxy-1-methylethyl)-, ethanedioate (1:1), with CAS number 1185303-91-6, is a chemical compound characterized by its complex structure, which includes a naphthalene ring system and an amine functional group. This compound features a methoxy group and an isopropyl substituent, contributing to its unique properties. The ethanedioate (oxalate) component indicates that it forms a salt or ester with oxalic acid, which can influence its solubility and reactivity. Generally, compounds of this nature may exhibit biological activity, potentially serving as intermediates in organic synthesis or as pharmacological agents. The presence of the naphthalene moiety often imparts aromatic characteristics, while the amine group can participate in hydrogen bonding, affecting the compound's interactions in various environments. Additionally, the methoxy group can enhance lipophilicity, influencing the compound's behavior in biological systems. Overall, this compound's characteristics make it of interest in both synthetic chemistry and potential applications in medicinal chemistry.
Formula:C15H19NO·C2H2O4
InChI:InChI=1S/C15H19NO.C2H2O4/c1-12(11-17-2)16-10-14-8-5-7-13-6-3-4-9-15(13)14;3-1(4)2(5)6/h3-9,12,16H,10-11H2,1-2H3;(H,3,4)(H,5,6)
InChI key:InChIKey=NKIIDLKFSBRNSA-UHFFFAOYSA-N
SMILES:C(NC(COC)C)C=1C2=C(C=CC1)C=CC=C2.C(C(O)=O)(O)=O
Synonyms:- 1-Naphthalenemethanamine, N-(2-methoxy-1-methylethyl)-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.