CAS 1185303-93-8

Piperidine, 2-(4-methyl-1H-pyrazol-3-yl)-, hydrochloride (1:2)

Description:

Piperidine, 2-(4-methyl-1H-pyrazol-3-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 4-methyl-1H-pyrazole moiety introduces additional reactivity and potential biological activity, as pyrazoles are known for their diverse pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit basic properties due to the nitrogen atoms in both the piperidine and pyrazole rings, allowing it to participate in protonation and coordination reactions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further characterization would typically involve spectroscopic methods to confirm its structure and purity.

Formula: C₉H₁₅N₃·2ClH

InChI: InChI=1S/C9H15N3.2ClH/c1-7-6-11-12-9(7)8-4-2-3-5-10-8;;/h6,8,10H,2-5H2,1H3,(H,11,12);2*1H

InChI key: InChIKey=LOSIYZFQRNMXLO-UHFFFAOYSA-N

SMILES: CC=1C(=NNC1)C2CCCCN2.Cl

Synonyms:

• Piperidine, 2-(4-methyl-1H-pyrazol-3-yl)-, hydrochloride (1:2)