CAS 1185303-99-4

Benzenamine, 4-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1)

Description:

Benzenamine, 4-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1), also known as a specific type of substituted aniline, is characterized by its aromatic amine structure, which includes a benzene ring and an amine functional group. The presence of a methoxy group on the phenyl ring enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other pathways. The hydrochloride form indicates that it can exist as a crystalline solid, which is advantageous for handling and formulation in various applications. Safety data should be consulted, as aromatic amines can pose health risks, including potential carcinogenicity. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic chemistry and medicinal applications.

Formula: C₁₅H₁₇NO·ClH

InChI: InChI=1S/C15H17NO.ClH/c1-17-15-4-2-3-13(11-15)6-5-12-7-9-14(16)10-8-12;/h2-4,7-11H,5-6,16H2,1H3;1H

InChI key: InChIKey=PTMJKXPCUKBUJF-UHFFFAOYSA-N

SMILES: C(CC1=CC=C(N)C=C1)C2=CC(OC)=CC=C2.Cl

Synonyms:

• Benzenamine, 4-[2-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1)