CymitQuimica logo

CAS 1185304-06-6

:

1-Piperazineethanamine, 4-methyl-β-phenyl-, hydrochloride (1:3)

Description:
1-Piperazineethanamine, 4-methyl-β-phenyl-, hydrochloride (1:3) is a chemical compound characterized by its piperazine and phenyl groups, which contribute to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperazine moiety suggests potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry for developing therapeutic agents. The compound's structure includes a β-phenyl group, which may influence its pharmacokinetic properties and receptor binding affinity. Its hydrochloride form indicates that it can exist as a stable crystalline solid, facilitating handling and formulation. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound's unique structural features position it as a candidate for further research in drug development and related fields.
Formula:C13H21N3·3ClH
InChI:InChI=1S/C13H21N3.3ClH/c1-15-7-9-16(10-8-15)13(11-14)12-5-3-2-4-6-12;;;/h2-6,13H,7-11,14H2,1H3;3*1H
InChI key:InChIKey=CZGALVMMCDVPFR-UHFFFAOYSA-N
SMILES:C(CN)(N1CCN(C)CC1)C2=CC=CC=C2.Cl
Synonyms:
  • 1-Piperazineethanamine, 4-methyl-β-phenyl-, hydrochloride (1:3)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.