CAS 1185304-13-5

Piperidine, 4-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a tert-butyl group, contributing to its hydrophobic properties. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often found in medicinal chemistry due to their ability to interact with biological targets. The compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structure and properties make it of interest in research and development within the fields of chemistry and pharmacology.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-16(2,3)14-4-6-15(7-5-14)18-12-13-8-10-17-11-9-13;/h4-7,13,17H,8-12H2,1-3H3;1H

InChI key: InChIKey=BESDYIJBOWPGTO-UHFFFAOYSA-N

SMILES: O(CC1CCNCC1)C2=CC=C(C(C)(C)C)C=C2.Cl

Synonyms:

• Piperidine, 4-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrochloride (1:1)