
CAS 1185304-17-9
:Piperidine, 3-[(3-methyl-2-buten-1-yl)oxy]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(3-methyl-2-buten-1-yl)oxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of the 3-methyl-2-buten-1-yl group indicates that it has an alkyl substituent that contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and it may participate in hydrogen bonding due to the presence of the hydroxyl group in the alkyl chain. Its structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C10H19NO·ClH
InChI:InChI=1S/C10H19NO.ClH/c1-9(2)5-7-12-10-4-3-6-11-8-10;/h5,10-11H,3-4,6-8H2,1-2H3;1H
InChI key:InChIKey=RVQIOVCFSWLQNM-UHFFFAOYSA-N
SMILES:O(CC=C(C)C)C1CCCNC1.Cl
Synonyms:- Piperidine, 3-[(3-methyl-2-buten-1-yl)oxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.