
CAS 1185304-24-8
:3-Pyrrolidinecarboxamide, N-[2-(1H-imidazol-1-yl)ethyl]-, hydrochloride (1:2)
Description:
3-Pyrrolidinecarboxamide, N-[2-(1H-imidazol-1-yl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and an imidazole moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments, which is beneficial for biological applications. The presence of the imidazole group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may exhibit properties such as moderate polarity, which can influence its pharmacokinetics and bioavailability. Additionally, the presence of both nitrogen-containing heterocycles may contribute to its potential as a ligand in various biochemical pathways. As with many compounds containing amide linkages, it may also exhibit stability under physiological conditions, although specific reactivity would depend on the surrounding environment. Overall, this compound's characteristics position it as a candidate for further research in drug development and related fields.
Formula:C10H16N4O·2ClH
InChI:InChI=1S/C10H16N4O.2ClH/c15-10(9-1-2-11-7-9)13-4-6-14-5-3-12-8-14;;/h3,5,8-9,11H,1-2,4,6-7H2,(H,13,15);2*1H
InChI key:InChIKey=XJJZLOWHWUPHDH-UHFFFAOYSA-N
SMILES:C(NCCN1C=CN=C1)(=O)C2CCNC2.Cl
Synonyms:- 3-Pyrrolidinecarboxamide, N-[2-(1H-imidazol-1-yl)ethyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.