CAS 1185304-38-4

Piperidine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a methoxy group attached to a 3-methylphenyl substituent indicates that this compound has both aromatic and aliphatic characteristics, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as analgesic, anti-inflammatory, or central nervous system effects, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.

Formula: C₁₃H₁₉NO·ClH

InChI: InChI=1S/C13H19NO.ClH/c1-11-3-2-4-12(9-11)10-15-13-5-7-14-8-6-13;/h2-4,9,13-14H,5-8,10H2,1H3;1H

InChI key: InChIKey=URERXPUJHMUFRQ-UHFFFAOYSA-N

SMILES: C(OC1CCNCC1)C2=CC(C)=CC=C2.Cl

Synonyms:

• Piperidine, 4-[(3-methylphenyl)methoxy]-, hydrochloride (1:1)