
CAS 1185304-40-8
:8-Azabicyclo[3.2.1]octane, 3-(4-morpholinyl)-, hydrochloride (1:2)
Description:
8-Azabicyclo[3.2.1]octane, 3-(4-morpholinyl)-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring system, contributing to its basicity and potential for forming salts, such as the hydrochloride form. The presence of the morpholine group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically utilized in research settings, particularly in studies related to neuropharmacology or as a potential therapeutic agent. Its hydrochloride salt form indicates that it is a stable, water-soluble derivative, which is advantageous for various applications, including drug formulation. The compound's molecular structure suggests potential interactions with biological targets, and its pharmacological properties would be determined through further experimental studies. As with many nitrogen-containing heterocycles, it may exhibit a range of activities, including analgesic or anxiolytic effects, depending on its specific interactions within biological systems.
Formula:C11H20N2O·2ClH
InChI:InChI=1S/C11H20N2O.2ClH/c1-2-10-8-11(7-9(1)12-10)13-3-5-14-6-4-13;;/h9-12H,1-8H2;2*1H
InChI key:InChIKey=WINADKDCDIORJW-UHFFFAOYSA-N
SMILES:C1(CC2NC(C1)CC2)N3CCOCC3.Cl
Synonyms:- 8-Azabicyclo[3.2.1]octane, 3-(4-morpholinyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.