CAS 1185304-44-2

Acetamide, N-[3-(2-aminophenoxy)phenyl]-, hydrochloride (1:1)

Description:

Acetamide, N-[3-(2-aminophenoxy)phenyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a phenyl ring substituted with an amino group and a phenoxy moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The presence of the amino group suggests potential basicity, while the acetamide structure indicates it may exhibit properties typical of amides, such as hydrogen bonding capabilities. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the context of drug design and development. Its specific interactions and applications would depend on its molecular structure and the functional groups present, which could influence its reactivity and biological properties. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₄H₁₄N₂O₂·ClH

InChI: InChI=1S/C14H14N2O2.ClH/c1-10(17)16-11-5-4-6-12(9-11)18-14-8-3-2-7-13(14)15;/h2-9H,15H2,1H3,(H,16,17);1H

InChI key: InChIKey=AAUQTOOIMFVVPN-UHFFFAOYSA-N

SMILES: O(C1=CC(NC(C)=O)=CC=C1)C2=C(N)C=CC=C2.Cl

Synonyms:

• Acetamide, N-[3-(2-aminophenoxy)phenyl]-, hydrochloride (1:1)