
CAS 1185304-50-0
:Benzenamine, 4-methyl-2-(3-phenylpropoxy)-, hydrochloride (1:1)
Description:
Benzenamine, 4-methyl-2-(3-phenylpropoxy)-, hydrochloride (1:1), also known by its CAS number 1185304-50-0, is a chemical compound characterized by its amine functional group and aromatic structure. This substance features a benzene ring substituted with a methyl group and a phenylpropoxy group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the amine group suggests potential basicity and reactivity, making it suitable for further chemical modifications. Its molecular structure indicates potential for interactions such as hydrogen bonding, which can influence its biological activity and solubility. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its behavior and potential uses in various fields.
Formula:C16H19NO·ClH
InChI:InChI=1S/C16H19NO.ClH/c1-13-9-10-15(17)16(12-13)18-11-5-8-14-6-3-2-4-7-14;/h2-4,6-7,9-10,12H,5,8,11,17H2,1H3;1H
InChI key:InChIKey=CHGSBGIYPVCLSN-UHFFFAOYSA-N
SMILES:O(CCCC1=CC=CC=C1)C2=C(N)C=CC(C)=C2.Cl
Synonyms:- Benzenamine, 4-methyl-2-(3-phenylpropoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.