
CAS 1185304-63-5
:3-Piperidinemethanamine, 1-[2-(4-chlorophenyl)ethyl]-N-methyl-, hydrochloride (1:2)
Description:
3-Piperidinemethanamine, 1-[2-(4-chlorophenyl)ethyl]-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and phenethylamine structure, which contributes to its potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmacological research. The compound may exhibit properties relevant to neurotransmitter modulation, making it of interest in the study of central nervous system effects. Its molecular structure suggests potential for interactions with receptors or enzymes, which could lead to therapeutic implications. However, detailed studies are necessary to fully understand its pharmacodynamics and pharmacokinetics. Safety and handling precautions should be observed, as with any chemical substance, particularly those with biological activity. Overall, this compound represents a class of molecules that could be explored for their medicinal properties, pending further investigation into their efficacy and safety profiles.
Formula:C15H23ClN2·2ClH
InChI:InChI=1S/C15H23ClN2.2ClH/c1-17-11-14-3-2-9-18(12-14)10-8-13-4-6-15(16)7-5-13;;/h4-7,14,17H,2-3,8-12H2,1H3;2*1H
InChI key:InChIKey=QDDIOMOADYXCOO-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Cl)C=C1)N2CC(CNC)CCC2.Cl
Synonyms:- 3-Piperidinemethanamine, 1-[2-(4-chlorophenyl)ethyl]-N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.