CymitQuimica logo

CAS 1185304-69-1

:

1-Piperazinepropanoic acid, 4-cyclohexyl-, hydrochloride (1:2)

Description:
1-Piperazinepropanoic acid, 4-cyclohexyl-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and cyclohexyl moieties, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid, indicating its solid-state at room temperature. It is soluble in water and polar organic solvents, which is common for hydrochloride salts due to their ionic nature. The presence of the piperazine ring suggests potential biological activity, as piperazine derivatives are often explored for pharmacological applications, including their roles as anxiolytics or antidepressants. The hydrochloride form enhances the compound's stability and solubility, making it suitable for various formulations. Additionally, the cyclohexyl group may influence the compound's lipophilicity and interaction with biological targets. Overall, this compound's structural features and solubility characteristics make it of interest in medicinal chemistry and pharmaceutical research.
Formula:C13H24N2O2·2ClH
InChI:InChI=1S/C13H24N2O2.2ClH/c16-13(17)6-7-14-8-10-15(11-9-14)12-4-2-1-3-5-12;;/h12H,1-11H2,(H,16,17);2*1H
InChI key:InChIKey=RKHJKBLBPMQRHR-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1CCN(CC1)C2CCCCC2.Cl
Synonyms:
  • 1-Piperazinepropanoic acid, 4-cyclohexyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.