CymitQuimica logo

CAS 1185304-80-6

:

1-Piperidineacetic acid, 2-methyl-, hydrochloride (1:1)

Description:
1-Piperidineacetic acid, 2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methyl group attached to the second carbon of the acetic acid moiety. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. This compound may be utilized in research and development, particularly in the synthesis of other chemical entities or as a building block in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions and the presence of other substances in a given environment.
Formula:C8H15NO2·ClH
InChI:InChI=1S/C8H15NO2.ClH/c1-7-4-2-3-5-9(7)6-8(10)11;/h7H,2-6H2,1H3,(H,10,11);1H
InChI key:InChIKey=ZGBIKDWEUIIJRI-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(C)CCCC1.Cl
Synonyms:
  • 1-Piperidineacetic acid, 2-methyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.