CAS 1185304-87-3

1-Piperazineethanol, α-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:2)

Description:

1-Piperazineethanol, α-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and phenoxy functional groups, which contribute to its potential biological activity. The presence of the piperazine ring suggests properties such as basicity and the ability to form hydrogen bonds, which can enhance solubility in polar solvents. The α-[[2-(2-propen-1-yl)phenoxy]methyl] moiety indicates a substitution pattern that may influence the compound's reactivity and interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound's structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₆H₂₄N₂O₂·2ClH

InChI: InChI=1S/C16H24N2O2.2ClH/c1-2-5-14-6-3-4-7-16(14)20-13-15(19)12-18-10-8-17-9-11-18;;/h2-4,6-7,15,17,19H,1,5,8-13H2;2*1H

InChI key: InChIKey=ARTYZUFMODLDLY-UHFFFAOYSA-N

SMILES: O(CC(CN1CCNCC1)O)C2=C(CC=C)C=CC=C2.Cl

Synonyms:

• 1-Piperazineethanol, α-[[2-(2-propen-1-yl)phenoxy]methyl]-, hydrochloride (1:2)