CymitQuimica logo

CAS 1185307-66-7

:

3-Pyridinecarboxylic acid, 2-(3-piperidinylamino)-, methyl ester, hydrochloride (1:2)

Description:
3-Pyridinecarboxylic acid, 2-(3-piperidinylamino)-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity and solubility properties. The presence of the carboxylic acid and methyl ester functional groups indicates that it can participate in various chemical reactions, such as esterification and amidation. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests it could interact with neurotransmitter systems or other biological pathways. The molecular structure allows for hydrogen bonding and potential interactions with proteins, making it of interest in medicinal chemistry. Overall, its characteristics make it a candidate for further investigation in drug development and therapeutic applications.
Formula:C12H17N3O2·2ClH
InChI:InChI=1S/C12H17N3O2.2ClH/c1-17-12(16)10-5-3-7-14-11(10)15-9-4-2-6-13-8-9;;/h3,5,7,9,13H,2,4,6,8H2,1H3,(H,14,15);2*1H
InChI key:InChIKey=COULBVBCQLGCQV-UHFFFAOYSA-N
SMILES:N(C1=C(C(OC)=O)C=CC=N1)C2CCCNC2.Cl
Synonyms:
  • 3-Pyridinecarboxylic acid, 2-(3-piperidinylamino)-, methyl ester, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.