CAS 1185307-77-0

6-Bromo-3-chloro-5-fluoro-2-pyridinecarbonitrile

Description:

6-Bromo-3-chloro-5-fluoro-2-pyridinecarbonitrile is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of multiple halogen substituents—bromine, chlorine, and fluorine—on the pyridine ring significantly influences its chemical reactivity and physical properties. The cyano group (-C≡N) attached to the carbon atom adjacent to the nitrogen in the pyridine structure contributes to its polarity and potential for nucleophilic reactions. This compound is typically used in pharmaceutical and agrochemical research due to its potential biological activity and ability to serve as an intermediate in the synthesis of more complex molecules. Its unique combination of halogen atoms may enhance its lipophilicity and alter its interaction with biological targets. Additionally, the presence of the cyano group can facilitate further chemical modifications, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₆HBrClFN₂

InChI: InChI=1S/C6HBrClFN2/c7-6-4(9)1-3(8)5(2-10)11-6/h1H

InChI key: InChIKey=VFWBDZYBRIIRHP-UHFFFAOYSA-N

SMILES: C(#N)C1=C(Cl)C=C(F)C(Br)=N1

Synonyms:

• 2-Pyridinecarbonitrile, 6-bromo-3-chloro-5-fluoro-
• 6-Bromo-3-chloro-5-fluoro-2-pyridinecarbonitrile