CAS 1185307-86-1

Pyridine, 5-nitro-2-(3-piperidinylmethoxy)-, hydrochloride (1:1)

Description:

Pyridine, 5-nitro-2-(3-piperidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a nitro group at the 5-position and a piperidinylmethoxy substituent at the 2-position contributes to its unique chemical properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in medicinal chemistry and pharmacology. The piperidine moiety may impart biological activity, potentially influencing its interaction with biological targets. As with many nitro-substituted compounds, it may exhibit specific reactivity patterns, including potential electrophilic behavior. Safety and handling precautions are essential, as nitro compounds can be sensitive to reduction and may pose health risks. Overall, this compound's structure suggests potential utility in research, particularly in the development of pharmaceuticals or as a chemical intermediate.

Formula: C₁₁H₁₅N₃O₃·ClH

InChI: InChI=1S/C11H15N3O3.ClH/c15-14(16)10-3-4-11(13-7-10)17-8-9-2-1-5-12-6-9;/h3-4,7,9,12H,1-2,5-6,8H2;1H

InChI key: InChIKey=FPXVMYSSMWIBRS-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=CC=C(N(=O)=O)C=N2.Cl

Synonyms:

• Pyridine, 5-nitro-2-(3-piperidinylmethoxy)-, hydrochloride (1:1)