CAS 1185307-93-0
:4-[[3-(Hydroxymethyl)-1-piperidinyl]methyl]-N,N-dimethylbenzenesulfonamide
Description:
4-[[3-(Hydroxymethyl)-1-piperidinyl]methyl]-N,N-dimethylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group, a piperidine ring, and a hydroxymethyl substituent. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity would depend on its interactions at the molecular level. The presence of the piperidine ring suggests that it may have psychoactive properties or influence neurotransmitter systems, as piperidine derivatives are often explored in medicinal chemistry. The dimethylamino group contributes to its basicity, potentially affecting solubility and reactivity. Additionally, the hydroxymethyl group can participate in hydrogen bonding, influencing the compound's interactions in biological systems. Overall, this compound's characteristics make it a subject of interest in pharmaceutical research, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H24N2O3S
InChI:InChI=1S/C15H24N2O3S/c1-16(2)21(19,20)15-7-5-13(6-8-15)10-17-9-3-4-14(11-17)12-18/h5-8,14,18H,3-4,9-12H2,1-2H3
InChI key:InChIKey=IJQMEOVWYRVHAF-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)C1=CC=C(CN2CC(CO)CCC2)C=C1
Synonyms:- Benzenesulfonamide, 4-[[3-(hydroxymethyl)-1-piperidinyl]methyl]-N,N-dimethyl-
- 4-[[3-(Hydroxymethyl)-1-piperidinyl]methyl]-N,N-dimethylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.