CymitQuimica logo

CAS 1185309-50-5

:

3-Piperidinamine, 1-(5-nitro-2-pyridinyl)-, hydrochloride (1:1)

Description:
3-Piperidinamine, 1-(5-nitro-2-pyridinyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a nitro group on the pyridine ring contributes to its potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development due to its structural features. Its molecular interactions can be influenced by the presence of the nitro group, which can affect electron distribution and hydrogen bonding capabilities. Additionally, the compound's characteristics, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. As with many nitrogen-containing compounds, it may also exhibit basicity, allowing it to participate in various chemical reactions.
Formula:C10H14N4O2·ClH
InChI:InChI=1S/C10H14N4O2.ClH/c11-8-2-1-5-13(7-8)10-4-3-9(6-12-10)14(15)16;/h3-4,6,8H,1-2,5,7,11H2;1H
InChI key:InChIKey=HLSUWRFINFHGHV-UHFFFAOYSA-N
SMILES:NC1CN(C2=CC=C(N(=O)=O)C=N2)CCC1.Cl
Synonyms:
  • 3-Piperidinamine, 1-(5-nitro-2-pyridinyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.