
CAS 1185309-86-7
:3-Pyridinecarboxylic acid, 2-(3-amino-1-piperidinyl)-, methyl ester, hydrochloride (1:2)
Description:
3-Pyridinecarboxylic acid, 2-(3-amino-1-piperidinyl)-, methyl ester, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity and solubility properties. The presence of the methyl ester group enhances its lipophilicity, potentially facilitating membrane permeability. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. The compound features an amino group that may participate in hydrogen bonding and interactions with biological targets, suggesting potential pharmacological activity. Its structure indicates that it may act as a ligand or modulator in various biochemical pathways. The compound's molecular interactions, stability, and solubility are influenced by its functional groups, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique structural features position it as a candidate for further research in therapeutic applications, particularly in areas related to neuropharmacology or other fields where piperidine derivatives are explored.
Formula:C12H17N3O2·2ClH
InChI:InChI=1S/C12H17N3O2.2ClH/c1-17-12(16)10-5-2-6-14-11(10)15-7-3-4-9(13)8-15;;/h2,5-6,9H,3-4,7-8,13H2,1H3;2*1H
InChI key:InChIKey=BWYYXSYJWSPCSX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N=CC=C1)N2CC(N)CCC2.Cl
Synonyms:- 3-Pyridinecarboxylic acid, 2-(3-amino-1-piperidinyl)-, methyl ester, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.