CymitQuimica logo

CAS 1185310-83-1

:

2-Pyridinamine, 4-methyl-N-4-piperidinyl-, hydrochloride (1:1)

Description:
2-Pyridinamine, 4-methyl-N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine and piperidine functional groups, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methyl group at the 4-position of the pyridine ring can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced efficacy or selectivity. Safety and handling precautions are essential, as with many amines and their salts, due to potential toxicity and reactivity. Overall, 2-Pyridinamine, 4-methyl-N-4-piperidinyl-, hydrochloride is a compound of interest in research and development, particularly in the context of drug discovery.
Formula:C11H17N3·ClH
InChI:InChI=1S/C11H17N3.ClH/c1-9-2-7-13-11(8-9)14-10-3-5-12-6-4-10;/h2,7-8,10,12H,3-6H2,1H3,(H,13,14);1H
InChI key:InChIKey=RPEXDBMNQDDBEU-UHFFFAOYSA-N
SMILES:N(C1=CC(C)=CC=N1)C2CCNCC2.Cl
Synonyms:
  • 2-Pyridinamine, 4-methyl-N-4-piperidinyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.