CAS 1185310-99-9

3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyridazine moieties. It typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and a chlorinated pyridazine ring, contributing to its potential biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, as it can interact with various biological targets. Its hydrochloride form indicates that it is a protonated species, which can influence its pharmacokinetics and bioavailability. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other interactions that are crucial for its function in biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₉H₁₃ClN₄·ClH

InChI: InChI=1S/C9H13ClN4.ClH/c10-8-3-4-9(13-12-8)14-5-1-2-7(11)6-14;/h3-4,7H,1-2,5-6,11H2;1H

InChI key: InChIKey=OMTXKQVIZQVCGZ-UHFFFAOYSA-N

SMILES: NC1CN(CCC1)C2=CC=C(Cl)N=N2.Cl

Synonyms:

• 3-Piperidinamine, 1-(6-chloro-3-pyridazinyl)-, hydrochloride (1:1)