CymitQuimica logo

CAS 1185314-68-4

:

Piperidine, 4-(2-thiazolyloxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(2-thiazolyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the thiazole moiety introduces a sulfur atom and contributes to the compound's unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand in medicinal chemistry, with implications for drug design and development. Its specific interactions and reactivity can be influenced by the functional groups present, making it of interest in the study of pharmacology and organic synthesis. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C8H12N2OS·ClH
InChI:InChI=1S/C8H12N2OS.ClH/c1-3-9-4-2-7(1)11-8-10-5-6-12-8;/h5-7,9H,1-4H2;1H
InChI key:InChIKey=MKLXPERPGCNXBP-UHFFFAOYSA-N
SMILES:O(C1CCNCC1)C2=NC=CS2.Cl
Synonyms:
  • Piperidine, 4-(2-thiazolyloxy)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.