CAS 1185319-47-4

4-Pyrimidinamine, N,N-diethyl-6-(1-piperazinyl)-, hydrochloride (1:1)

Description:

4-Pyrimidinamine, N,N-diethyl-6-(1-piperazinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a diethylamino group and a piperazine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit properties such as being a potential ligand for various biological targets, and its structure suggests possible interactions with neurotransmitter systems. Its molecular structure allows for various functional modifications, which can influence its pharmacological profile. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound represents a class of molecules that may have therapeutic implications, particularly in the fields of neuropharmacology or oncology, although specific biological activities would require further investigation.

Formula: C₁₂H₂₁N₅·ClH

InChI: InChI=1S/C12H21N5.ClH/c1-3-16(4-2)11-9-12(15-10-14-11)17-7-5-13-6-8-17;/h9-10,13H,3-8H2,1-2H3;1H

InChI key: InChIKey=SUILTDYOXPIZTJ-UHFFFAOYSA-N

SMILES: N(CC)(CC)C1=CC(=NC=N1)N2CCNCC2.Cl

Synonyms:

• 4-Pyrimidinamine, N,N-diethyl-6-(1-piperazinyl)-, hydrochloride (1:1)

N,N-Diethyl-6-(piperazin-1-yl)pyrimidin-4-amine hydrochloride

CAS: 1185319-47-4

Formula: C₁₂H₂₂ClN₅

Purity: 95%

Molecular weight: 271.7896

Ref: IN-DA008ZKM

N,N-Diethyl-6-(piperazin-1-yl)pyrimidin-4-amine hydrochloride

CAS: 1185319-47-4

N,N-Diethyl-6-(piperazin-1-yl)pyrimidin-4-amine hydrochloride

Purity: 95%

Molecular weight: 271.8g/mol

Ref: 54-OR1050092