
CAS 1185319-52-1
:3-Piperidinamine, 1-(6-methoxy-4-pyrimidinyl)-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-(6-methoxy-4-pyrimidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyrimidine moieties, which contribute to its biological activity. The presence of the piperidinamine structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The methoxy group on the pyrimidine ring enhances its lipophilicity, potentially improving membrane permeability and bioavailability. As a hydrochloride salt, it is typically more soluble in water, facilitating formulation in aqueous solutions for therapeutic use. The compound's molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the pyrimidine ring. Its specific pharmacological properties would depend on the precise arrangement of functional groups and their electronic effects, which can influence receptor binding and enzyme inhibition. Overall, this compound represents a class of small molecules that may exhibit significant biological activity, warranting further investigation in drug discovery and development contexts.
Formula:C10H16N4O·ClH
InChI:InChI=1S/C10H16N4O.ClH/c1-15-10-5-9(12-7-13-10)14-4-2-3-8(11)6-14;/h5,7-8H,2-4,6,11H2,1H3;1H
InChI key:InChIKey=MYECZFZVVZKAJX-UHFFFAOYSA-N
SMILES:O(C)C1=CC(=NC=N1)N2CC(N)CCC2.Cl
Synonyms:- 3-Piperidinamine, 1-(6-methoxy-4-pyrimidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(6-Methoxypyrimidin-4-yl)piperidin-3-amine hydrochloride
CAS:Formula:C10H17ClN4OMolecular weight:244.7212
