CAS 1185319-63-4

5-Bromo-2-(methoxy-d3)pyridine

Description:

5-Bromo-2-(methoxy-d3)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and physical properties. The methoxy-d3 group at the 2-position indicates the presence of a methoxy group (–OCH3) that is deuterated, meaning that the hydrogen atoms in the methoxy group are replaced with deuterium isotopes. This substitution can be useful in studies involving isotopic labeling, particularly in NMR spectroscopy and kinetic studies. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and form. Its solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals make it of interest in various fields of research. As with many brominated compounds, it may exhibit specific biological activities or serve as a precursor in synthetic pathways.

Formula: C₆H₃BrD₃NO

InChI: InChI=1S/C6H6BrNO/c1-9-6-3-2-5(7)4-8-6/h2-4H,1H3/i1D3

InChI key: InChIKey=XADICJHFELMBGX-FIBGUPNXSA-N

SMILES: O(C([2H])([2H])[2H])C1=CC=C(Br)C=N1

Synonyms:

• 5-Bromo-2-(methoxy-d3)pyridine
• Pyridine, 5-bromo-2-(methoxy-d3)-