CAS 1185319-71-4

Piperidine, 4-(2-methyl-5-phenyl-1H-pyrrol-1-yl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(2-methyl-5-phenyl-1H-pyrrol-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a pyrrol moiety substituted at the 4-position of the piperidine ring, contributing to its unique properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in polar solvents, particularly water. This compound may exhibit biological activity due to the presence of both piperidine and pyrrol structures, which are often found in various pharmacologically active compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The compound's characteristics, such as melting point, boiling point, and specific reactivity, would typically be determined through experimental methods, and its safety profile would need to be assessed for handling and usage in laboratory settings.

Formula: C₁₆H₂₀N₂·ClH

InChI: InChI=1S/C16H20N2.ClH/c1-13-7-8-16(14-5-3-2-4-6-14)18(13)15-9-11-17-12-10-15;/h2-8,15,17H,9-12H2,1H3;1H

InChI key: InChIKey=SBNJMZLRSARWJB-UHFFFAOYSA-N

SMILES: CC=1N(C(=CC1)C2=CC=CC=C2)C3CCNCC3.Cl

Synonyms:

• Piperidine, 4-(2-methyl-5-phenyl-1H-pyrrol-1-yl)-, hydrochloride (1:1)

4-(2-Methyl-5-phenyl-1H-pyrrol-1-yl)piperidine hydrochloride

CAS: 1185319-71-4

Formula: C₁₆H₂₁ClN₂

Molecular weight: 276.8043

Ref: IN-DA008ZK9