CAS 1185320-30-2
:6,7-Dihydro-1H-[1,4]dioxino[2,3-f]benzotriazole
Description:
6,7-Dihydro-1H-[1,4]dioxino[2,3-f]benzotriazole is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both dioxin and benzotriazole moieties. This compound features a fused dioxin ring system, which contributes to its stability and potential reactivity. The presence of the benzotriazole unit enhances its electronic properties, making it of interest in various applications, including materials science and organic synthesis. Typically, compounds of this nature exhibit interesting photophysical properties, which may include fluorescence or phosphorescence, depending on their specific structural features. Additionally, the compound may possess biological activity, making it a candidate for further investigation in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the substituents present and the conditions under which it is studied. Overall, 6,7-Dihydro-1H-[1,4]dioxino[2,3-f]benzotriazole represents a class of compounds that are valuable for research and potential applications in various fields of chemistry.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-2-13-8-4-6-5(9-11-10-6)3-7(8)12-1/h3-4H,1-2H2,(H,9,10,11)
InChI key:InChIKey=NAMMFDOALFUXLI-UHFFFAOYSA-N
SMILES:C=12C(=CC3=C(C1)OCCO3)N=NN2
Synonyms:- 6,7-Dihydro-1H-[1,4]dioxino[2,3-f]benzotriazole
- 1H-[1,4]Dioxino[2,3-f]benzotriazole, 6,7-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
