CAS 118546-30-8

N-[4-(1H-indol-3-yl)butanoyl]-L-alanine

Description:

N-[4-(1H-indol-3-yl)butanoyl]-L-alanine, also known by its CAS number 118546-30-8, is a synthetic compound that features a unique structure combining an indole moiety with an L-alanine amino acid. This compound is characterized by its potential biological activity, particularly in the context of pharmacology and biochemistry, where it may interact with various biological targets due to the presence of the indole ring, which is known for its role in many natural products and pharmaceuticals. The butanoyl group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. As a derivative of L-alanine, it retains the properties of amino acids, including the ability to participate in peptide bond formation. The compound's specific interactions and effects in biological systems would depend on its conformation and the presence of functional groups, making it a subject of interest for further research in medicinal chemistry and drug development.

Formula: C₁₅H₁₈N₂O₃

InChI: InChI=1/C15H18N2O3/c1-10(15(19)20)17-14(18)8-4-5-11-9-16-13-7-3-2-6-12(11)13/h2-3,6-7,9-10,16H,4-5,8H2,1H3,(H,17,18)(H,19,20)/t10-/m0/s1

SMILES: C[C@@H](C(=O)O)N=C(CCCc1c[nH]c2ccccc12)O

Indole-3-butyryl-L-alanine

Controlled Product

CAS: 118546-30-8

Formula: C₁₅H₁₈N₂O₃

Color and Shape: Neat

Molecular weight: 274.315

Ref: TR-I577775