CAS 1185514-83-3
:N-[2-[[[5-[[Di(methyl-d3)amino]methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-1,1-ethenediamine
Description:
N-[2-[[[5-[[Di(methyl-d3)amino]methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-1,1-ethenediamine is a complex organic compound characterized by its unique molecular structure, which includes a furan ring, a nitro group, and a thioether linkage. The presence of the di(methyl-d3)amino group indicates that it contains deuterated methyl groups, which can be useful in studies involving isotopic labeling. This compound likely exhibits properties typical of nitrogen-containing organic molecules, such as potential solubility in organic solvents and reactivity due to the presence of functional groups like the nitro and amino groups. Its structure suggests potential applications in medicinal chemistry or as a research chemical, although specific biological activities or applications would require further investigation. The compound's CAS number, 1185514-83-3, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this substance represents a specialized chemical entity with potential relevance in various scientific fields.
Formula:C13H16D6N4O3S
InChI:InChI=1S/C13H22N4O3S/c1-14-13(9-17(18)19)15-6-7-21-10-12-5-4-11(20-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3/i2D3,3D3
InChI key:InChIKey=VMXUWOKSQNHOCA-XERRXZQWSA-N
SMILES:C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])C=1OC(CSCCNC(=CN(=O)=O)NC)=CC1
Synonyms:- 1,1-Ethenediamine, N-[2-[[[5-[[di(methyl-d3)amino]methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-
- Ranitidine-d6
- N-[2-[[[5-[[Di(methyl-d3)amino]methyl]-2-furanyl]methyl]thio]ethyl]-N′-methyl-2-nitro-1,1-ethenediamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ranitidine-d6
CAS:Controlled Product<p>Applications Ranitidine-d6 is a labeled histamine H2-receptor antagonist which inhibits gastric acid secretion. Antiulcerative.<br>References Bradshaw, J., et al.: Brit. J. Pharmacol., 66, 464 (1979); Berstad, A., et al.: Scand. J. Gastroenterol, 15, 637 (1980); Hohnjec, M., et al.: Anal. Profiles Drug Subs., 15, 533 (1986)<br></p>Formula:C132H6H16N4O3SColor and Shape:NeatMolecular weight:320.44Ranitidine-d6
CAS:Ranitidine is a drug that belongs to the class of histamine-2 receptor antagonists. It has been shown to inhibit the transport of synthetic cathinones, such as methylone, in wastewater samples. Ranitidine is also used to study the potential use of this drug in the treatment of carcinogenesis. Ranitidine-d6 is a radioactive form of ranitidine and can be used for research purposes. This drug is used for the diagnosis and imaging of tumors and other body organs by utilizing positron emission tomography (PET) scans.Formula:C13H22N4O3SPurity:Min. 95%Molecular weight:320.44 g/mol

