CAS 118562-73-5
:2-Cyclododecylpropan-1-ol
Description:
2-Cyclododecylpropan-1-ol, with the CAS number 118562-73-5, is an organic compound characterized by its long hydrocarbon chain and the presence of a hydroxyl (-OH) functional group. This compound features a cyclododecyl group, which is a twelve-membered carbon ring, attached to a propanol backbone. The presence of the hydroxyl group indicates that it is an alcohol, which typically imparts properties such as increased solubility in polar solvents and the ability to participate in hydrogen bonding. The structure suggests that it may exhibit hydrophobic characteristics due to the large non-polar cyclododecyl moiety, while still retaining some polar characteristics from the alcohol functional group. This dual nature can influence its behavior in various chemical environments, making it potentially useful in applications such as surfactants, lubricants, or as intermediates in organic synthesis. Additionally, the compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and structural configuration.
Formula:C15H30O
InChI:InChI=1S/C15H30O/c1-14(13-16)15-11-9-7-5-3-2-4-6-8-10-12-15/h14-16H,2-13H2,1H3
InChI key:InChIKey=WKHTUDYDJUHYMK-UHFFFAOYSA-N
SMILES:C(CO)(C)C1CCCCCCCCCCC1
Synonyms:- 2-(Cyclododecyl1)-propan-1-ol
- Cyclododecaneethanol, beta-methyl-
- 2-Cyclododecylpropan-1-ol
- β-Methylcyclododecaneethanol
- Cyclododecaneethanol, β-methyl-
- 2-Cyclododecylpropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.