CymitQuimica logo

CAS 1185729-41-2

:

L-Histidine, 2-oxopentanedioate (1:1)

Description:
L-Histidine, 2-oxopentanedioate (1:1) is a chemical compound that combines the amino acid L-histidine with 2-oxopentanedioic acid, also known as α-ketoglutaric acid. This compound is characterized by its role in various biochemical processes, particularly in amino acid metabolism and the synthesis of proteins. L-histidine is an essential amino acid that serves as a precursor for histamine and plays a critical role in enzyme function and cellular signaling. The 2-oxopentanedioate component contributes to the compound's potential as a metabolic intermediate. The molecular structure typically features a carboxylate group, which can participate in various chemical reactions, including those involving enzyme catalysis. This compound may exhibit solubility in water and has potential applications in nutritional supplements and pharmaceuticals, particularly in formulations aimed at enhancing metabolic health or supporting athletic performance. Its specific properties, such as stability and reactivity, can vary depending on environmental conditions like pH and temperature.
Formula:C6H9N3O2·C5H6O5
InChI:InChI=1S/C6H9N3O2.C5H6O5/c7-5(6(10)11)1-4-2-8-3-9-4;6-3(5(9)10)1-2-4(7)8/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1-2H2,(H,7,8)(H,9,10)/t5-;/m0./s1
InChI key:InChIKey=NEZITABMBWLXRB-JEDNCBNOSA-N
SMILES:C(CCC(O)=O)(C(O)=O)=O.C([C@@H](C(O)=O)N)C1=CN=CN1
Synonyms:
  • L-Histidine, 2-oxopentanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.