CymitQuimica logo

CAS 118573-52-7

:

4-Hydroxy-1H-indole-3-acetonitrile

Description:
4-Hydroxy-1H-indole-3-acetonitrile, with the CAS number 118573-52-7, is an organic compound that features a bicyclic indole structure with a hydroxyl group and a nitrile functional group. This compound is characterized by its aromatic nature, which contributes to its stability and reactivity. The presence of the hydroxyl group (-OH) enhances its solubility in polar solvents and can participate in hydrogen bonding, while the acetonitrile moiety introduces a nitrile group (-C≡N), which is known for its ability to act as a versatile building block in organic synthesis. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with various biological targets. Additionally, it can be synthesized through various organic reactions, making it accessible for research purposes. Overall, 4-Hydroxy-1H-indole-3-acetonitrile is a compound of interest due to its structural features and potential applications in chemical and pharmaceutical research.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-5-4-7-6-12-8-2-1-3-9(13)10(7)8/h1-3,6,12-13H,4H2
InChI key:InChIKey=RWBSUCOEZMIDSA-UHFFFAOYSA-N
SMILES:C(C#N)C=1C=2C(NC1)=CC=CC2O
Synonyms:
  • 2-(4-Hydroxy-1H-indol-3-yl)acetonitrile
  • 4-Hydroxy-1H-indole-3-acetonitrile
  • 4-Hydroxy-3-indoleacetonitrile
  • 1H-Indole-3-acetonitrile, 4-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.