CAS 118573-58-3
:levomecol
Description:
Levomecol, with the CAS number 118573-58-3, is a topical pharmaceutical formulation primarily used for its wound healing and antimicrobial properties. It is characterized by its composition, which typically includes an antibiotic (such as methyluracil) and a polyethylene glycol (PEG) base, allowing for effective penetration and moisture retention at the application site. Levomecol is known for its ability to promote granulation tissue formation and enhance the healing process in various types of wounds, including burns and ulcers. The formulation is designed to be non-irritating and is often used in clinical settings due to its compatibility with different types of wounds. Its mechanism of action involves both antibacterial effects and stimulation of cellular regeneration, making it a valuable option in wound management. Additionally, Levomecol is generally well-tolerated, with minimal side effects, which contributes to its widespread use in dermatological and surgical applications.
Formula:C16H18Cl2N4O7
InChI:InChI=1/C11H12Cl2N2O5.C5H6N2O2/c12-10(13)11(18)14-8(5-16)9(17)6-1-3-7(4-2-6)15(19)20;1-3-2-6-5(9)7-4(3)8/h1-4,8-10,16-17H,5H2,(H,14,18);2H,1H3,(H2,6,7,8,9)/t8-,9-;/m1./s1
SMILES:c1cc(ccc1[C@H]([C@@H](CO)N=C(C(Cl)Cl)O)O)N(=O)=O.Cc1cnc(nc1O)O
Synonyms:- (R-(R*,R*))-2,2-Dichloro-N-(2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)acetamide
- Acetamide, 2,2-dichloro-N-(2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)-, (R-(R*,R*))-, mixt. with 5-methyl-2,4(1H,3H)-pyrimidinedione
- 2,2-dichloro-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl]acetamide - 5-methylpyrimidine-2,4(1H,3H)-dione (1:1)
- Levomecol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Levomecol
CAS:Levomekol is a topical antibiotic ointment, which is a synthesized pharmaceutical product with antibacterial and anti-inflammatory properties. It contains chloramphenicol, a broad-spectrum antibiotic, and methyluracil, which promotes tissue repair and regeneration. The mode of action involves the inhibition of bacterial protein synthesis by binding to the 50S ribosomal subunit of susceptible microorganisms, effectively curbing bacterial growth and proliferation. Concurrently, methyluracil stimulates leukocyte activity and enhances the healing process by promoting cellular regeneration and collagen production.
Formula:C16H18Cl2N4O7Purity:Min. 95%Molecular weight:449.2 g/molLevomecol
CAS:Levomecol: Streptomyces-made antibiotic with Chloramphenicol & Methyluracil, halts bacterial growth by blocking protein synthesis.Formula:C16H18Cl2N4O7Purity:98%Color and Shape:SolidMolecular weight:449.24

