
CAS 1185767-08-1
:4,6-Difluoro-1-methyl-1H-indazole
Description:
4,6-Difluoro-1-methyl-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of two fluorine atoms at the 4 and 6 positions of the indazole ring significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The methyl group at the 1-position contributes to its overall stability and can affect its interaction with biological targets. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that may confer specific biological activities. Additionally, the fluorine substituents can enhance metabolic stability and influence the compound's pharmacokinetic properties. As with many fluorinated compounds, 4,6-Difluoro-1-methyl-1H-indazole may exhibit interesting electronic properties, making it a subject of interest in various fields, including drug design and materials science.
Formula:C8H6F2N2
InChI:InChI=1S/C8H6F2N2/c1-12-8-3-5(9)2-7(10)6(8)4-11-12/h2-4H,1H3
InChI key:InChIKey=ALATZHJJHGFEMD-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC(F)=C1)N(C)N=C2
Synonyms:- 4,6-Difluoro-1-methyl-1H-indazole
- 1H-Indazole, 4,6-difluoro-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
