CymitQuimica logo

CAS 1185836-87-6

:

5-(Cyclopropylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole

Description:
5-(Cyclopropylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole is a complex organic compound characterized by its unique structural features, which include a benzodioxole core and a dioxaborolane moiety. The presence of the cyclopropylmethoxy group contributes to its potential reactivity and solubility properties. This compound may exhibit interesting pharmacological activities due to its structural motifs, which can influence interactions with biological targets. The dioxaborolane group is known for its ability to participate in various chemical reactions, including cross-coupling reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the presence of multiple functional groups suggests that it may have diverse applications in medicinal chemistry or materials science. Its specific physical and chemical properties, such as melting point, boiling point, solubility, and stability, would need to be determined experimentally, as they can vary significantly based on the compound's environment and formulation. Overall, this compound represents a valuable entity for further research and development in various chemical fields.
Formula:C17H23BO5
InChI:InChI=1S/C17H23BO5/c1-16(2)17(3,4)23-18(22-16)14-12(19-9-11-5-6-11)7-8-13-15(14)21-10-20-13/h7-8,11H,5-6,9-10H2,1-4H3
InChI key:InChIKey=PABIRHZQYSSGOS-UHFFFAOYSA-N
SMILES:O(CC1CC1)C=2C(=C3C(=CC2)OCO3)B4OC(C)(C)C(C)(C)O4
Synonyms:
  • 1,3-Benzodioxole, 5-(cyclopropylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 5-Cyclopropylmethoxy-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)benzo[1,3]dioxole
  • 5-(Cyclopropylmethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzodioxole
  • 5-Cyclopropylmethoxy-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)benzodioxole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.