CymitQuimica logo

CAS 1185836-97-8

:

2-[2-(Cyclopropylmethoxy)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[2-(Cyclopropylmethoxy)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted phenyl group. The presence of the cyclopropylmethoxy group and a fluorine atom on the phenyl ring contributes to its potential reactivity and solubility properties. This compound is likely to exhibit moderate polarity due to the combination of its hydrophobic cyclopropyl moiety and the polar dioxaborolane functional group. The dioxaborolane structure is known for its ability to participate in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. Additionally, the presence of the fluorine atom may enhance the compound's biological activity and lipophilicity. Overall, this compound's unique combination of functional groups and structural characteristics positions it as a potentially useful intermediate in the development of pharmaceuticals or agrochemicals.
Formula:C16H22BFO3
InChI:InChI=1S/C16H22BFO3/c1-15(2)16(3,4)21-17(20-15)13-9-12(18)7-8-14(13)19-10-11-5-6-11/h7-9,11H,5-6,10H2,1-4H3
InChI key:InChIKey=NHLRLZUBOLMQLU-UHFFFAOYSA-N
SMILES:O(CC1CC1)C2=C(B3OC(C)(C)C(C)(C)O3)C=C(F)C=C2
Synonyms:
  • 2-[2-(Cyclopropylmethoxy)-5-fluorophenyl]-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane
  • 1,3,2-Dioxaborolane, 2-[2-(cyclopropylmethoxy)-5-fluorophenyl]-4,4,5,5-tetramethyl-
  • 2-[2-(Cyclopropylmethoxy)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-Cyclopropylmethoxy-5-fluorophenylboronic acid pinacol ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.