CAS 118584-19-3

7-[[(2E,6R)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-2H-1-benzopyran-2-one

Description:

The chemical substance known as "7-[[(2E,6R)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-2H-1-benzopyran-2-one," with the CAS number 118584-19-3, is a flavonoid compound characterized by its complex structure that includes a benzopyran moiety and a long aliphatic side chain. This compound exhibits properties typical of flavonoids, such as antioxidant activity, which can contribute to its potential health benefits. The presence of hydroxyl groups in its structure enhances its reactivity and solubility in polar solvents. Additionally, the specific stereochemistry indicated by the (2E,6R) configuration suggests that it may exhibit unique biological activities, possibly influencing its interaction with biological targets. Flavonoids are known for their role in plant pigmentation and defense, and this compound may also play a role in plant metabolism or signaling. Its potential applications could extend to pharmaceuticals, nutraceuticals, or as a natural product in food chemistry, although further research would be necessary to fully elucidate its properties and applications.

Formula: C₁₉H₂₂O₄

InChI: InChI=1S/C19H22O4/c1-13(2)17(20)8-4-14(3)10-11-22-16-7-5-15-6-9-19(21)23-18(15)12-16/h5-7,9-10,12,17,20H,1,4,8,11H2,2-3H3/b14-10+/t17-/m1/s1

InChI key: InChIKey=OWAQHJLCKMIPKB-IDKBZEPQSA-N

SMILES: O(C/C=C(/CC[C@H](C(C)=C)O)\C)C=1C=C2C(=CC1)C=CC(=O)O2

Synonyms:

• 7-[[(2E,6R)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-2H-1-benzopyran-2-one
• 2H-1-Benzopyran-2-one, 7-[(6-hydroxy-3,7-dimethyl-2,7-octadienyl)oxy]-, [R-(E)]-
• 2H-1-Benzopyran-2-one, 7-[[(2E,6R)-6-hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-

2H-1-Benzopyran-2-one, 7-[[(2E,6R)-6-hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-

CAS: 118584-19-3

Formula: C₁₉H₂₂O₄

Purity: 96.5%

Molecular weight: 314.3756

Ref: IN-DA01SBL5

7-(6'R-Hydroxy-3',7'-dimethylocta-2',7'-dienyloxy)coumarin

CAS: 118584-19-3

7-(6'R-Hydroxy-3',7'-dimethylocta-2',7'-dienyloxy)coumarin is a coumarin derivative, which is a type of organic compound widely studied for its potential therapeutic properties. This compound is typically sourced from natural plant metabolites, where it forms as a result of biosynthetic pathway modifications involving the phenylpropanoid pathway. Its mode of action is primarily associated with the inhibition of specific enzymes or the modulation of molecular pathways, which can influence various biological activities such as anti-inflammatory or antioxidant responses.

Formula: C₁₉H₂₂O₄

Purity: Min. 95%

Molecular weight: 314.4 g/mol

Ref: 3D-TEA58419