CymitQuimica logo

CAS 1186-73-8

:

1,1,1-Trimethyl methanetricarboxylate

Description:
1,1,1-Trimethyl methanetricarboxylate, with the CAS number 1186-73-8, is an organic compound characterized by its structure, which includes three carboxylate groups attached to a central carbon atom that is also bonded to three methyl groups. This compound is a derivative of methanetricarboxylic acid and is known for its high reactivity due to the presence of multiple carboxyl functional groups. It typically appears as a colorless to pale yellow liquid and is soluble in polar organic solvents. The presence of multiple carboxyl groups allows it to participate in various chemical reactions, making it useful in organic synthesis and as a building block in the production of more complex molecules. Additionally, it may exhibit properties such as being a potential ligand in coordination chemistry or serving as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety data should be consulted, as it may pose hazards typical of carboxylic acids and esters, including irritation to skin and eyes.
Formula:C7H10O6
InChI:InChI=1S/C7H10O6/c1-11-5(8)4(6(9)12-2)7(10)13-3/h4H,1-3H3
InChI key:InChIKey=BNOIMFITGLLJTH-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(C(OC)=O)C(OC)=O
Synonyms:
  • 1,1,1-Trimethyl methanetricarboxylate
  • Methanetricarboxylic acid, 1,1,1-trimethyl ester
  • Methanetricarboxylic acid, trimethyl ester
  • Tricarbomethoxymethane
  • Trimethyl methanetricarboxylate
Found 4 products.