
CAS 1186012-80-5
:rel-(1R,3S,3aR,8bS)-3a-(4-Bromophenyl)-1,2,3,3a-tetrahydro-6,8-dimethoxy-3-phenyl-8bH-cyclopenta[b]benzofuran-1,8b-diol
Description:
The chemical substance known as rel-(1R,3S,3aR,8bS)-3a-(4-Bromophenyl)-1,2,3,3a-tetrahydro-6,8-dimethoxy-3-phenyl-8bH-cyclopenta[b]benzofuran-1,8b-diol, with the CAS number 1186012-80-5, is a complex organic compound characterized by its multi-ring structure and specific stereochemistry. It features a cyclopenta[b]benzofuran core, which is a fused bicyclic system, indicating potential for interesting chemical reactivity and biological activity. The presence of multiple methoxy groups suggests that it may exhibit unique electronic properties and solubility characteristics. The bromophenyl substituent can enhance its lipophilicity and may influence its interaction with biological targets. Additionally, the stereochemical configuration (1R,3S,3aR,8bS) implies that the compound may exhibit chirality, which can affect its pharmacological properties and interactions in biological systems. Overall, this compound's structural complexity and functional groups suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents.
Formula:C25H23BrO5
InChI:InChI=1/C25H23BrO5/c1-29-18-12-20(30-2)23-21(13-18)31-25(16-8-10-17(26)11-9-16)19(14-22(27)24(23,25)28)15-6-4-3-5-7-15/h3-13,19,22,27-28H,14H2,1-2H3/t19-,22+,24+,25-/s2
InChI key:InChIKey=ACIXIVSDWSWVDW-BQAHITKDNA-N
SMILES:O[C@]12[C@]([C@@H](C[C@H]1O)C3=CC=CC=C3)(OC=4C2=C(OC)C=C(OC)C4)C5=CC=C(Br)C=C5
Synonyms:- rel-(1R,3S,3aR,8bS)-3a-(4-Bromophenyl)-1,2,3,3a-tetrahydro-6,8-dimethoxy-3-phenyl-8bH-cyclopenta[b]benzofuran-1,8b-diol
- FL 3 (flavagline)
- 8bH-Cyclopenta[b]benzofuran-1,8b-diol, 3a-(4-bromophenyl)-1,2,3,3a-tetrahydro-6,8-dimethoxy-3-phenyl-, (1R,3S,3aR,8bS)-rel-
- FL 3
- FL3 (flavagline)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
FL3
CAS:FL3 is a novel potent eIF4F inhibitor, it induces the death of cancer cells by an original mechanism that involves the apoptosis-inducing factor and caspase 12.Formula:C25H23BrO5Color and Shape:SolidMolecular weight:483.35
