CAS 118604-70-9

2-Ethyl-N-[(1S)-2-methoxy-1-methylethyl]-6-methylbenzenamine

Description:

2-Ethyl-N-[(1S)-2-methoxy-1-methylethyl]-6-methylbenzenamine, with the CAS number 118604-70-9, is an organic compound characterized by its amine functional group and a complex structure that includes a substituted benzene ring. This compound features an ethyl group and a methoxy group attached to a chiral center, contributing to its stereochemistry. The presence of the methyl groups on the benzene ring enhances its hydrophobic characteristics, which can influence its solubility and reactivity. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The specific arrangement of substituents affects its physical properties, such as boiling point and melting point, as well as its potential applications in pharmaceuticals or agrochemicals. Additionally, the stereochemistry of the compound may play a significant role in its biological activity and interaction with other molecules. Overall, this compound represents a unique structure within the realm of organic chemistry, with potential implications in various fields.

Formula: C₁₃H₂₁NO

InChI: InChI=1S/C13H21NO/c1-5-12-8-6-7-10(2)13(12)14-11(3)9-15-4/h6-8,11,14H,5,9H2,1-4H3/t11-/m0/s1

InChI key: InChIKey=YXWIRQHVEQIJOV-NSHDSACASA-N

SMILES: N([C@H](COC)C)C1=C(CC)C=CC=C1C

Synonyms:

• 2-Ethyl-N-[(1S)-2-methoxy-1-methylethyl]-6-methylbenzenamine
• Benzenamine, 2-ethyl-N-[(1S)-2-methoxy-1-methylethyl]-6-methyl-
• 2-Ethyl-N-[(2S)-1-methoxypropan-2-yl]-6-methylaniline
• Benzenamine, 2-ethyl-N-(2-methoxy-1-methylethyl)-6-methyl-, (S)-