
CAS 1186041-97-3
:1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]-2-pyrrolidinone
Description:
1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]-2-pyrrolidinone, with the CAS number 1186041-97-3, is a chemical compound characterized by its unique structural features, which include a pyrrolidinone ring and a pyrazine moiety linked to a boron-containing dioxaborolane. This compound is notable for its potential applications in medicinal chemistry, particularly in drug development and synthesis due to the presence of the boron atom, which can enhance reactivity and facilitate various chemical transformations. The dioxaborolane group is known for its ability to participate in cross-coupling reactions, making it valuable in organic synthesis. Additionally, the presence of nitrogen-containing heterocycles like pyrazine and pyrrolidinone may impart specific biological activities, contributing to its relevance in pharmaceutical research. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the surrounding environment, making it a subject of interest for further studies in both synthetic and medicinal chemistry.
Formula:C14H20BN3O3
InChI:InChI=1S/C14H20BN3O3/c1-13(2)14(3,4)21-15(20-13)10-8-17-11(9-16-10)18-7-5-6-12(18)19/h8-9H,5-7H2,1-4H3
InChI key:InChIKey=FCTPREVGGZRDSL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(=CN2)N3C(=O)CCC3
Synonyms:- 2-Pyrrolidinone, 1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]-
- 1-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrazinyl]-2-pyrrolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.