
CAS 1186047-29-9
:2-Methoxy-N-(tetrahydro-2H-pyran-4-yl)acetamide
Description:
2-Methoxy-N-(tetrahydro-2H-pyran-4-yl)acetamide is an organic compound characterized by its unique functional groups and structural features. It contains a methoxy group (-OCH3), which contributes to its polarity and solubility in organic solvents. The presence of the tetrahydro-2H-pyran moiety introduces a cyclic structure that can influence the compound's reactivity and steric properties. This compound is likely to exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the presence of functional groups and the overall molecular environment. Its acetamide functional group (-C(=O)N-) suggests potential for hydrogen bonding, which can affect its boiling and melting points, as well as its solubility in various solvents. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, given the structural motifs that are often found in biologically active molecules. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-11-6-8(10)9-7-2-4-12-5-3-7/h7H,2-6H2,1H3,(H,9,10)
InChI key:InChIKey=XGJALXAJBPUTBT-UHFFFAOYSA-N
SMILES:N(C(COC)=O)C1CCOCC1
Synonyms:- Acetamide, 2-methoxy-N-(tetrahydro-2H-pyran-4-yl)-
- 2-Methoxy-N-(oxan-4-yl)acetamide
- 2-Methoxy-N-(tetrahydro-2H-pyran-4-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.