CAS 1186049-49-9

N-(4-Methoxyphenyl)-1-(phenylmethyl)-4-piperidinecarboxamide

Description:

N-(4-Methoxyphenyl)-1-(phenylmethyl)-4-piperidinecarboxamide, identified by its CAS number 1186049-49-9, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a methoxy group attached to a phenyl ring, contributing to its lipophilicity and potential biological activity. The presence of the phenylmethyl group enhances its structural complexity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential analgesic or anti-inflammatory effects. The molecular structure suggests that it may engage in hydrogen bonding and hydrophobic interactions, which are crucial for its activity in biological systems. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for further research in medicinal chemistry and drug development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function.

Formula: C₂₀H₂₄N₂O₂

InChI: InChI=1S/C20H24N2O2/c1-24-19-9-7-18(8-10-19)21-20(23)17-11-13-22(14-12-17)15-16-5-3-2-4-6-16/h2-10,17H,11-15H2,1H3,(H,21,23)

InChI key: InChIKey=GJFMBUUKNHBDOX-UHFFFAOYSA-N

SMILES: C(N1CCC(C(NC2=CC=C(OC)C=C2)=O)CC1)C3=CC=CC=C3

Synonyms:

• 4-Piperidinecarboxamide, N-(4-methoxyphenyl)-1-(phenylmethyl)-
• 1-Benzyl-piperidine-4-carboxylic acid (4-methoxy-phenyl)-amide
• N-(4-Methoxyphenyl)-1-(phenylmethyl)-4-piperidinecarboxamide

DDO-02001

CAS: 1186049-49-9

DDO-02001 can be used in anti-arrhythmia research. DDO-02001 is a moderately potent inhibitor of Kv1.5 potassium channel with an IC50 value of 17.7 μM [1].

Formula: C₂₀H₂₄N₂O₂

Color and Shape: Solid

Molecular weight: 324.42

Ref: TM-T60892