CAS 1186194-33-1
:Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether
Description:
Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether, identified by its CAS number 1186194-33-1, is a synthetic polymer that combines polyethylene glycol (PEG) with amino and carboxyethyl functional groups. This compound typically exhibits hydrophilic properties due to the presence of the polyethylene glycol backbone, which enhances its solubility in water and biocompatibility. The aminoethyl group can participate in various chemical reactions, making it useful for conjugation and modification in biochemical applications. The carboxyethyl moiety provides additional functionality, allowing for potential interactions with other molecules, which can be advantageous in drug delivery systems and bioconjugation strategies. The substance is generally non-toxic and is often utilized in pharmaceutical formulations, cosmetics, and as a surfactant. Its characteristics, such as molecular weight, viscosity, and reactivity, can vary depending on the specific formulation and degree of polymerization, making it versatile for various industrial and research applications.
Formula:(C2H4O)nC5H11NO3
InChI:InChI=1S/C7H15NO4/c8-2-4-12-6-5-11-3-1-7(9)10/h1-6,8H2,(H,9,10)
InChI key:InChIKey=DEZXLFKSYRODPB-UHFFFAOYSA-N
SMILES:O(CCOCCN)CCC(O)=O
Synonyms:- O-(2-Aminoethyl)-O′-(2-carboxyethyl)polyethylene glycol
- Thermo Scientific Carboxy-PEG-Amine
- Poly(oxy-1,2-ethanediyl), α-(2-aminoethyl)-ω-(2-carboxyethoxy)-
- Polyethylene glycol 2-aminoethyl 2-carboxyethyl ether
- NH2-PEG10-COOH
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.